About methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate
methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate (PubChem CID 170187834) has the molecular formula C15H11Cl2N3O2S
and a molecular weight of 368.25 g/mol. Its IUPAC name is methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate.
Molecular Properties
| Compound Name | methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate |
| PubChem CID | 170187834 |
| Molecular Formula | C15H11Cl2N3O2S |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate |
| SMILES | CS/C(=N\c1c(C=O)cc(Cl)nc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H11Cl2N3O2S/c1-23-15(20-14(22)9-5-3-2-4-6-9)19-12-10(8-21)7-11(16)18-13(12)17/h2-8H,1H3,(H,19,20,22) |
| InChIKey | KNEVOAYPBBLPEM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate?
The IUPAC name of methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate (CID 170187834) is methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate.
What is the SMILES notation for methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate?
The canonical SMILES for methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate is CS/C(=N\c1c(C=O)cc(Cl)nc1Cl)NC(=O)c1ccccc1.
What is the InChIKey of methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate?
The InChIKey is KNEVOAYPBBLPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O2S/c1-23-15(20-14(22)9-5-3-2-4-6-9)19-12-10(8-21)7-11(16)18-13(12)17/h2-8H,1H3,(H,19,20,22).
What are the key properties of methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate?
methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate has a molecular weight of 368.25 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-benzoyl-N'-(2,6-dichloro-4-formyl-3-pyridinyl)carbamimidothioate is sourced from PubChem (CID 170187834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).