C23H23F2NO3 — CID 170188252
(3R,3aS,4R,5S,7aS)-6,6-difluoro-3,5-dimethyl-1-oxo-N,N-diphenyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carboxamide (PubChem CID 170188252) has the molecular formula C23H23F2NO3 and a molecular weight of 399.44 g/mol. Its IUPAC name is (3R,3aS,4R,5S,7aS)-6,6-difluoro-3,5-dimethyl-1-oxo-N,N-diphenyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carboxamide.
| Compound Name | (3R,3aS,4R,5S,7aS)-6,6-difluoro-3,5-dimethyl-1-oxo-N,N-diphenyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 170188252 |
| Molecular Formula | C23H23F2NO3 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (3R,3aS,4R,5S,7aS)-6,6-difluoro-3,5-dimethyl-1-oxo-N,N-diphenyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-4-carboxamide |
| SMILES | C[C@H]1OC(=O)[C@H]2CC(F)(F)[C@@H](C)[C@H](C(=O)N(c3ccccc3)c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C23H23F2NO3/c1-14-19(20-15(2)29-22(28)18(20)13-23(14,24)25)21(27)26(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14-15,18-20H,13H2,1-2H3/t14-,15+,18-,19-,20+/m0/s1 |
| InChIKey | AQHGZLSRKIJHHX-SBCNTATESA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |