C29H45N7O6 — CID 170188381
(5S)-5-[[2-(butylamino)acetyl]amino]-N-methyl-N'-[1-[2-[(3-methyl-1-azabicyclo[3.3.1]nonan-2-yl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide (PubChem CID 170188381) has the molecular formula C29H45N7O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is (5S)-5-[[2-(butylamino)acetyl]amino]-N-methyl-N'-[1-[2-[(3-methyl-1-azabicyclo[3.3.1]nonan-2-yl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide.
| Compound Name | (5S)-5-[[2-(butylamino)acetyl]amino]-N-methyl-N'-[1-[2-[(3-methyl-1-azabicyclo[3.3.1]nonan-2-yl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide |
|---|---|
| PubChem CID | 170188381 |
| Molecular Formula | C29H45N7O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | (5S)-5-[[2-(butylamino)acetyl]amino]-N-methyl-N'-[1-[2-[(3-methyl-1-azabicyclo[3.3.1]nonan-2-yl)amino]-2-oxoethyl]-2-oxo-3-pyridinyl]-2-oxohexanediamide |
| SMILES | CCCCNCC(=O)N[C@@H](CCC(=O)C(=O)NC)C(=O)Nc1cccn(CC(=O)NC2C(C)CC3CCCN2C3)c1=O |
| InChI | InChI=1S/C29H45N7O6/c1-4-5-12-31-16-24(38)32-21(10-11-23(37)28(41)30-3)27(40)33-22-9-7-14-36(29(22)42)18-25(39)34-26-19(2)15-20-8-6-13-35(26)17-20/h7,9,14,19-21,26,31H,4-6,8,10-13,15-18H2,1-3H3,(H,30,41)(H,32,38)(H,33,40)(H,34,39)/t19?,20?,21-,26?/m0/s1 |
| InChIKey | MGWIAKZSHXTPGS-CIABRFPXSA-N |
| XLogP | -0.05 |
| TPSA | 170.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|