C28H25ClF3NO3 — CID 170188869
6-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-4-yl]-2,7-difluoro-3-hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde (PubChem CID 170188869) has the molecular formula C28H25ClF3NO3 and a molecular weight of 515.96 g/mol. Its IUPAC name is 6-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-4-yl]-2,7-difluoro-3-hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde.
| Compound Name | 6-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-4-yl]-2,7-difluoro-3-hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde |
|---|---|
| PubChem CID | 170188869 |
| Molecular Formula | C28H25ClF3NO3 |
| Molecular Weight | 515.96 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 6-[2-(4-aminobutyl)-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-4-yl]-2,7-difluoro-3-hydroxy-2,3-dihydro-1H-indene-5-carbaldehyde |
| SMILES | NCCCCC1(c2ccccc2)Cc2c(cc(F)c(Cl)c2-c2c(C=O)cc3c(c2F)CC(F)C3O)O1 |
| InChI | InChI=1S/C28H25ClF3NO3/c29-25-20(30)12-22-19(13-28(36-22,8-4-5-9-33)16-6-2-1-3-7-16)24(25)23-15(14-34)10-18-17(26(23)32)11-21(31)27(18)35/h1-3,6-7,10,12,14,21,27,35H,4-5,8-9,11,13,33H2 |
| InChIKey | YHTJGMAOYQNIGR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|