C51H35N3OS — CID 170189203
2-cyclohexa-1,3-dien-1-yl-4-(4-dibenzofuran-2-ylphenyl)-6-(6,8-diphenyl-1,9b-dihydrodibenzothiophen-1-yl)-1,3,5-triazine (PubChem CID 170189203) has the molecular formula C51H35N3OS and a molecular weight of 737.93 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-4-(4-dibenzofuran-2-ylphenyl)-6-(6,8-diphenyl-1,9b-dihydrodibenzothiophen-1-yl)-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-4-(4-dibenzofuran-2-ylphenyl)-6-(6,8-diphenyl-1,9b-dihydrodibenzothiophen-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170189203 |
| Molecular Formula | C51H35N3OS |
| Molecular Weight | 737.93 g/mol |
| Exact Mass | 737.25 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-4-(4-dibenzofuran-2-ylphenyl)-6-(6,8-diphenyl-1,9b-dihydrodibenzothiophen-1-yl)-1,3,5-triazine |
| SMILES | C1=CCCC(c2nc(-c3ccc(-c4ccc5oc6ccccc6c5c4)cc3)nc(C3C=CC=C4Sc5c(-c6ccccc6)cc(-c6ccccc6)cc5C43)n2)=C1 |
| InChI | InChI=1S/C51H35N3OS/c1-4-13-32(14-5-1)38-30-41(34-15-6-2-7-16-34)48-43(31-38)47-40(20-12-22-46(47)56-48)51-53-49(35-17-8-3-9-18-35)52-50(54-51)36-25-23-33(24-26-36)37-27-28-45-42(29-37)39-19-10-11-21-44(39)55-45/h1-8,10-17,19-31,40,47H,9,18H2 |
| InChIKey | OFJKZGYOQNLFKT-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.93 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |