C22H30N2O2 — CID 170189392
2-amino-N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxybenzamide (PubChem CID 170189392) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-amino-N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxybenzamide.
| Compound Name | 2-amino-N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 170189392 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2-amino-N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]-N-hydroxybenzamide |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)CN(O)C(=O)c2ccccc2N)C[C@H]1C(=C)C |
| InChI | InChI=1S/C22H30N2O2/c1-6-22(5)12-11-17(13-19(22)15(2)3)16(4)14-24(26)21(25)18-9-7-8-10-20(18)23/h6-10,17,19,26H,1-2,4,11-14,23H2,3,5H3/t17-,19+,22-/m1/s1 |
| InChIKey | HVRQZLJMJLLOSY-ZWCUEREDSA-N |
| XLogP | 4.84 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|