About 6-methyl-9,10-dioxoanthracene-1-carbonitrile
6-methyl-9,10-dioxoanthracene-1-carbonitrile (PubChem CID 170189874) has the molecular formula C16H9NO2
and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-methyl-9,10-dioxoanthracene-1-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-9,10-dioxoanthracene-1-carbonitrile |
| PubChem CID | 170189874 |
| Molecular Formula | C16H9NO2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 6-methyl-9,10-dioxoanthracene-1-carbonitrile |
| SMILES | Cc1ccc2c(c1)C(=O)c1cccc(C#N)c1C2=O |
| InChI | InChI=1S/C16H9NO2/c1-9-5-6-11-13(7-9)15(18)12-4-2-3-10(8-17)14(12)16(11)19/h2-7H,1H3 |
| InChIKey | UIWUXJKHXJRPON-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-9,10-dioxoanthracene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-9,10-dioxoanthracene-1-carbonitrile?
The IUPAC name of 6-methyl-9,10-dioxoanthracene-1-carbonitrile (CID 170189874) is 6-methyl-9,10-dioxoanthracene-1-carbonitrile.
What is the SMILES notation for 6-methyl-9,10-dioxoanthracene-1-carbonitrile?
The canonical SMILES for 6-methyl-9,10-dioxoanthracene-1-carbonitrile is Cc1ccc2c(c1)C(=O)c1cccc(C#N)c1C2=O.
What is the InChIKey of 6-methyl-9,10-dioxoanthracene-1-carbonitrile?
The InChIKey is UIWUXJKHXJRPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9NO2/c1-9-5-6-11-13(7-9)15(18)12-4-2-3-10(8-17)14(12)16(11)19/h2-7H,1H3.
What are the key properties of 6-methyl-9,10-dioxoanthracene-1-carbonitrile?
6-methyl-9,10-dioxoanthracene-1-carbonitrile has a molecular weight of 247.25 g/mol, XLogP of 2.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-9,10-dioxoanthracene-1-carbonitrile is sourced from PubChem (CID 170189874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).