C14H24F2N3+ — CID 170190053
[[(1Z)-2-amino-4-(2,2-dimethylpropyl)-8,8-difluorocycloocten-1-yl]amino]-methylidyneazanium (PubChem CID 170190053) has the molecular formula C14H24F2N3+ and a molecular weight of 272.36 g/mol. Its IUPAC name is [[(1Z)-2-amino-4-(2,2-dimethylpropyl)-8,8-difluorocycloocten-1-yl]amino]-methylidyneazanium.
| Compound Name | [[(1Z)-2-amino-4-(2,2-dimethylpropyl)-8,8-difluorocycloocten-1-yl]amino]-methylidyneazanium |
|---|---|
| PubChem CID | 170190053 |
| Molecular Formula | C14H24F2N3+ |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | [[(1Z)-2-amino-4-(2,2-dimethylpropyl)-8,8-difluorocycloocten-1-yl]amino]-methylidyneazanium |
| SMILES | C#[N+]N/C1=C(\N)CC(CC(C)(C)C)CCCC1(F)F |
| InChI | InChI=1S/C14H24F2N3/c1-13(2,3)9-10-6-5-7-14(15,16)12(19-18-4)11(17)8-10/h4,10,19H,5-9,17H2,1-3H3/q+1/b12-11- |
| InChIKey | FZZSSHTWRPBLIN-QXMHVHEDSA-N |
| XLogP | 3.89 |
| TPSA | 42.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|