C16H20BrO2PS2 — CID 170190957
(2S,3aR,5S,7aR)-2-(4-bromophenoxy)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole (PubChem CID 170190957) has the molecular formula C16H20BrO2PS2 and a molecular weight of 419.35 g/mol. Its IUPAC name is (2S,3aR,5S,7aR)-2-(4-bromophenoxy)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole.
| Compound Name | (2S,3aR,5S,7aR)-2-(4-bromophenoxy)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole |
|---|---|
| PubChem CID | 170190957 |
| Molecular Formula | C16H20BrO2PS2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | (2S,3aR,5S,7aR)-2-(4-bromophenoxy)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphole |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)O[P@](=S)(Oc3ccc(Br)cc3)S[C@@H]2C1 |
| InChI | InChI=1S/C16H20BrO2PS2/c1-11(2)12-8-9-16(3)15(10-12)22-20(21,19-16)18-14-6-4-13(17)5-7-14/h4-7,12,15H,1,8-10H2,2-3H3/t12-,15+,16+,20-/m0/s1 |
| InChIKey | UKQRWTAXCYKGCP-WJBZZZKMSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|