C19H28N2 — CID 170191031
1-[2-[(1R,2S,5R)-5-but-1-en-2-yl-2-ethenyl-2-methylcyclohexyl]prop-2-enyl]pyrazole (PubChem CID 170191031) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-[2-[(1R,2S,5R)-5-but-1-en-2-yl-2-ethenyl-2-methylcyclohexyl]prop-2-enyl]pyrazole.
| Compound Name | 1-[2-[(1R,2S,5R)-5-but-1-en-2-yl-2-ethenyl-2-methylcyclohexyl]prop-2-enyl]pyrazole |
|---|---|
| PubChem CID | 170191031 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 1-[2-[(1R,2S,5R)-5-but-1-en-2-yl-2-ethenyl-2-methylcyclohexyl]prop-2-enyl]pyrazole |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)CC)C[C@H]1C(=C)Cn1cccn1 |
| InChI | InChI=1S/C19H28N2/c1-6-15(3)17-9-10-19(5,7-2)18(13-17)16(4)14-21-12-8-11-20-21/h7-8,11-12,17-18H,2-4,6,9-10,13-14H2,1,5H3/t17-,18+,19-/m1/s1 |
| InChIKey | ZOHMRDMKTXHHCW-CEXWTWQISA-N |
| XLogP | 5.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|