About (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole
(4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole (PubChem CID 170191140) has the molecular formula C9H11F3N2
and a molecular weight of 204.19 g/mol. Its IUPAC name is (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole.
Molecular Properties
| Compound Name | (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole |
| PubChem CID | 170191140 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole |
| SMILES | C/C=c1/nc(C(F)(F)F)n(C)/c1=C/C |
| InChI | InChI=1S/C9H11F3N2/c1-4-6-7(5-2)14(3)8(13-6)9(10,11)12/h4-5H,1-3H3/b6-4+,7-5+ |
| InChIKey | BAUFMRFJSOBRQW-YDFGWWAZSA-N |
| XLogP | 1.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole?
The IUPAC name of (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole (CID 170191140) is (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole.
What is the SMILES notation for (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole?
The canonical SMILES for (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole is C/C=c1/nc(C(F)(F)F)n(C)/c1=C/C.
What is the InChIKey of (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole?
The InChIKey is BAUFMRFJSOBRQW-YDFGWWAZSA-N. The full InChI is InChI=1S/C9H11F3N2/c1-4-6-7(5-2)14(3)8(13-6)9(10,11)12/h4-5H,1-3H3/b6-4+,7-5+.
What are the key properties of (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole?
(4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole has a molecular weight of 204.19 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4,5-di(ethylidene)-1-methyl-2-(trifluoromethyl)imidazole is sourced from PubChem (CID 170191140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).