About [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane
[[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane (PubChem CID 170191274) has the molecular formula C9H13F2N2P
and a molecular weight of 218.19 g/mol. Its IUPAC name is [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane.
Molecular Properties
| Compound Name | [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane |
| PubChem CID | 170191274 |
| Molecular Formula | C9H13F2N2P |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane |
| SMILES | C/C=c1/nc(C(F)(F)P)n(C)/c1=C/C |
| InChI | InChI=1S/C9H13F2N2P/c1-4-6-7(5-2)13(3)8(12-6)9(10,11)14/h4-5H,14H2,1-3H3/b6-4+,7-5+ |
| InChIKey | XBSWXRQFFRCCEM-YDFGWWAZSA-N |
| XLogP | 0.95 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane?
The IUPAC name of [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane (CID 170191274) is [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane.
What is the SMILES notation for [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane?
The canonical SMILES for [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane is C/C=c1/nc(C(F)(F)P)n(C)/c1=C/C.
What is the InChIKey of [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane?
The InChIKey is XBSWXRQFFRCCEM-YDFGWWAZSA-N. The full InChI is InChI=1S/C9H13F2N2P/c1-4-6-7(5-2)13(3)8(12-6)9(10,11)14/h4-5H,14H2,1-3H3/b6-4+,7-5+.
What are the key properties of [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane?
[[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane has a molecular weight of 218.19 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[(4E,5E)-4,5-di(ethylidene)-1-methylimidazol-2-yl]-difluoromethyl]phosphane is sourced from PubChem (CID 170191274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).