C15H22N2 — CID 170191307
1-[2-[(1R,2R)-2-ethenyl-2,3-dimethylcyclopentyl]prop-2-enyl]pyrazole (PubChem CID 170191307) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-[2-[(1R,2R)-2-ethenyl-2,3-dimethylcyclopentyl]prop-2-enyl]pyrazole.
| Compound Name | 1-[2-[(1R,2R)-2-ethenyl-2,3-dimethylcyclopentyl]prop-2-enyl]pyrazole |
|---|---|
| PubChem CID | 170191307 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-[2-[(1R,2R)-2-ethenyl-2,3-dimethylcyclopentyl]prop-2-enyl]pyrazole |
| SMILES | C=C[C@]1(C)C(C)CC[C@H]1C(=C)Cn1cccn1 |
| InChI | InChI=1S/C15H22N2/c1-5-15(4)13(3)7-8-14(15)12(2)11-17-10-6-9-16-17/h5-6,9-10,13-14H,1-2,7-8,11H2,3-4H3/t13?,14-,15+/m0/s1 |
| InChIKey | JKGQVKYWWZDVRV-NOYMGPGASA-N |
| XLogP | 3.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|