C24H26O2S5 — CID 170191904
S-[3-[2-[2-[3-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylethylsulfanyl]ethylsulfanyl]phenyl] 2-methylprop-2-enethioate (PubChem CID 170191904) has the molecular formula C24H26O2S5 and a molecular weight of 506.81 g/mol. Its IUPAC name is S-[3-[2-[2-[3-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylethylsulfanyl]ethylsulfanyl]phenyl] 2-methylprop-2-enethioate.
| Compound Name | S-[3-[2-[2-[3-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylethylsulfanyl]ethylsulfanyl]phenyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 170191904 |
| Molecular Formula | C24H26O2S5 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | S-[3-[2-[2-[3-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylethylsulfanyl]ethylsulfanyl]phenyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)Sc1cccc(SCCSCCSc2cccc(SC(=O)C(=C)C)c2)c1 |
| InChI | InChI=1S/C24H26O2S5/c1-17(2)23(25)30-21-9-5-7-19(15-21)28-13-11-27-12-14-29-20-8-6-10-22(16-20)31-24(26)18(3)4/h5-10,15-16H,1,3,11-14H2,2,4H3 |
| InChIKey | WZJQNHIGXOGMND-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|