C26H36N4O7S — CID 170192286
2-[2-[N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,5-dimethoxy-4-[(4-methyl-1,3-benzothiazol-2-yl)diazenyl]anilino]ethoxy]ethanol (PubChem CID 170192286) has the molecular formula C26H36N4O7S and a molecular weight of 548.66 g/mol. Its IUPAC name is 2-[2-[N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,5-dimethoxy-4-[(4-methyl-1,3-benzothiazol-2-yl)diazenyl]anilino]ethoxy]ethanol.
| Compound Name | 2-[2-[N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,5-dimethoxy-4-[(4-methyl-1,3-benzothiazol-2-yl)diazenyl]anilino]ethoxy]ethanol |
|---|---|
| PubChem CID | 170192286 |
| Molecular Formula | C26H36N4O7S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 2-[2-[N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2,5-dimethoxy-4-[(4-methyl-1,3-benzothiazol-2-yl)diazenyl]anilino]ethoxy]ethanol |
| SMILES | COc1cc(N(CCOCCO)CCOCCOCCO)c(OC)cc1/N=N/c1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C26H36N4O7S/c1-19-5-4-6-24-25(19)27-26(38-24)29-28-20-17-23(34-3)21(18-22(20)33-2)30(7-11-35-13-9-31)8-12-36-15-16-37-14-10-32/h4-6,17-18,31-32H,7-16H2,1-3H3/b29-28+ |
| InChIKey | SSRQDQGOTWDYOO-ZQHSETAFSA-N |
| XLogP | 3.88 |
| TPSA | 127.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|