1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride

C2F6O4S2 — CID 170192332

IUPAC1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride
SMILESO=S(=O)(F)C(F)(C(F)(F)F)S(=O)(=O)F
InChIInChI=1S/C2F6O4S2/c3-1(4,5)2(6,13(7,9)10)14(8,11)12
InChIKeyREOPSRFEUDRNSG-UHFFFAOYSA-N
MW266.14 g/mol
LogP0.77
Rot. Bonds2

About 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride

1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride (PubChem CID 170192332) has the molecular formula C2F6O4S2 and a molecular weight of 266.14 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride.

Molecular Properties

Compound Name1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride
PubChem CID170192332
Molecular FormulaC2F6O4S2
Molecular Weight266.14 g/mol
Exact Mass265.91
IUPAC Name1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride
SMILESO=S(=O)(F)C(F)(C(F)(F)F)S(=O)(=O)F
InChIInChI=1S/C2F6O4S2/c3-1(4,5)2(6,13(7,9)10)14(8,11)12
InChIKeyREOPSRFEUDRNSG-UHFFFAOYSA-N
XLogP0.77
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.14
LogP ≤ 50.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride?
The IUPAC name of 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride (CID 170192332) is 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride.
What is the SMILES notation for 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride?
The canonical SMILES for 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride is O=S(=O)(F)C(F)(C(F)(F)F)S(=O)(=O)F.
What is the InChIKey of 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride?
The InChIKey is REOPSRFEUDRNSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6O4S2/c3-1(4,5)2(6,13(7,9)10)14(8,11)12.
What are the key properties of 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride?
1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride has a molecular weight of 266.14 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,2,2-tetrafluoroethane-1,1-disulfonyl fluoride is sourced from PubChem (CID 170192332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).