C16H32N2 — CID 170192673
2-N'-(5-cyclobutyl-2,5-dimethyl-4-methylidenehexan-3-yl)propane-2,2-diamine (PubChem CID 170192673) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-N'-(5-cyclobutyl-2,5-dimethyl-4-methylidenehexan-3-yl)propane-2,2-diamine.
| Compound Name | 2-N'-(5-cyclobutyl-2,5-dimethyl-4-methylidenehexan-3-yl)propane-2,2-diamine |
|---|---|
| PubChem CID | 170192673 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-N'-(5-cyclobutyl-2,5-dimethyl-4-methylidenehexan-3-yl)propane-2,2-diamine |
| SMILES | C=C(C(NC(C)(C)N)C(C)C)C(C)(C)C1CCC1 |
| InChI | InChI=1S/C16H32N2/c1-11(2)14(18-16(6,7)17)12(3)15(4,5)13-9-8-10-13/h11,13-14,18H,3,8-10,17H2,1-2,4-7H3 |
| InChIKey | PXBIDGWHXSYDPS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|