C21H39NO — CID 170193639
1-[(2S,4S)-4-[(2R)-2-butyl-2,5-dimethylhex-5-enyl]-2,4-dimethylpiperidin-2-yl]ethenol (PubChem CID 170193639) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is 1-[(2S,4S)-4-[(2R)-2-butyl-2,5-dimethylhex-5-enyl]-2,4-dimethylpiperidin-2-yl]ethenol.
| Compound Name | 1-[(2S,4S)-4-[(2R)-2-butyl-2,5-dimethylhex-5-enyl]-2,4-dimethylpiperidin-2-yl]ethenol |
|---|---|
| PubChem CID | 170193639 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | 1-[(2S,4S)-4-[(2R)-2-butyl-2,5-dimethylhex-5-enyl]-2,4-dimethylpiperidin-2-yl]ethenol |
| SMILES | C=C(C)CC[C@@](C)(CCCC)C[C@@]1(C)CCN[C@](C)(C(=C)O)C1 |
| InChI | InChI=1S/C21H39NO/c1-8-9-11-19(5,12-10-17(2)3)15-20(6)13-14-22-21(7,16-20)18(4)23/h22-23H,2,4,8-16H2,1,3,5-7H3/t19-,20-,21+/m1/s1 |
| InChIKey | FMTNSBHDESPTAI-NJYVYQBISA-N |
| XLogP | 6.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|