C22H12N4O2 — CID 170193758
6,16-dimethyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione (PubChem CID 170193758) has the molecular formula C22H12N4O2 and a molecular weight of 364.36 g/mol. Its IUPAC name is 6,16-dimethyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione.
| Compound Name | 6,16-dimethyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione |
|---|---|
| PubChem CID | 170193758 |
| Molecular Formula | C22H12N4O2 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 6,16-dimethyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione |
| SMILES | CN1C(=O)c2cnc3c4ccc5c6c(cnc(c7ccc1c2c73)c64)C(=O)N5C |
| InChI | InChI=1S/C22H12N4O2/c1-25-13-5-3-9-17-15(13)11(21(25)27)7-23-19(17)10-4-6-14-16-12(22(28)26(14)2)8-24-20(9)18(10)16/h3-8H,1-2H3 |
| InChIKey | WAFQBCXCKAWQNB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|