About N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide
N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide (PubChem CID 170194022) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide |
| PubChem CID | 170194022 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide |
| SMILES | C=C(Cc1ccc(C)c(C)c1)Nc1ccc(Oc2cc(NC(C)=O)ncn2)cc1 |
| InChI | InChI=1S/C23H24N4O2/c1-15-5-6-19(11-16(15)2)12-17(3)26-20-7-9-21(10-8-20)29-23-13-22(24-14-25-23)27-18(4)28/h5-11,13-14,26H,3,12H2,1-2,4H3,(H,24,25,27,28) |
| InChIKey | OAXVEGHEAXTFFI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide?
The IUPAC name of N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide (CID 170194022) is N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide?
The canonical SMILES for N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide is C=C(Cc1ccc(C)c(C)c1)Nc1ccc(Oc2cc(NC(C)=O)ncn2)cc1.
What is the InChIKey of N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide?
The InChIKey is OAXVEGHEAXTFFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-15-5-6-19(11-16(15)2)12-17(3)26-20-7-9-21(10-8-20)29-23-13-22(24-14-25-23)27-18(4)28/h5-11,13-14,26H,3,12H2,1-2,4H3,(H,24,25,27,28).
What are the key properties of N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide?
N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide has a molecular weight of 388.47 g/mol, XLogP of 5.01, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-[4-[3-(3,4-dimethylphenyl)prop-1-en-2-ylamino]phenoxy]pyrimidin-4-yl]acetamide is sourced from PubChem (CID 170194022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).