C22H23NS — CID 170194372
1-(3,8-dimethylidenecyclodeca-1,4,6,9-tetraen-1-yl)-2-ethenylsulfanyl-N-[(1Z)-3-methylbuta-1,3-dienyl]prop-2-en-1-imine (PubChem CID 170194372) has the molecular formula C22H23NS and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-(3,8-dimethylidenecyclodeca-1,4,6,9-tetraen-1-yl)-2-ethenylsulfanyl-N-[(1Z)-3-methylbuta-1,3-dienyl]prop-2-en-1-imine.
| Compound Name | 1-(3,8-dimethylidenecyclodeca-1,4,6,9-tetraen-1-yl)-2-ethenylsulfanyl-N-[(1Z)-3-methylbuta-1,3-dienyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 170194372 |
| Molecular Formula | C22H23NS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(3,8-dimethylidenecyclodeca-1,4,6,9-tetraen-1-yl)-2-ethenylsulfanyl-N-[(1Z)-3-methylbuta-1,3-dienyl]prop-2-en-1-imine |
| SMILES | C=CSC(=C)/C(=N\C=C/C(=C)C)c1ccc(=C)ccccc(=C)c1 |
| InChI | InChI=1S/C22H23NS/c1-7-24-20(6)22(23-15-14-17(2)3)21-13-12-18(4)10-8-9-11-19(5)16-21/h7-16H,1-2,4-6H2,3H3/b10-8-,11-9+,13-12+,15-14-,21-16+,23-22+ |
| InChIKey | HQKCEJKABSRSDI-PDSINBLPSA-N |
| XLogP | 4.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|