C28H34F3N5O2 — CID 170194463
[4-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] (E)-N-[(E)-but-1-enyl]-3-[(3R)-3-methylpiperazin-1-yl]but-2-enimidate (PubChem CID 170194463) has the molecular formula C28H34F3N5O2 and a molecular weight of 529.61 g/mol. Its IUPAC name is [4-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] (E)-N-[(E)-but-1-enyl]-3-[(3R)-3-methylpiperazin-1-yl]but-2-enimidate.
| Compound Name | [4-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] (E)-N-[(E)-but-1-enyl]-3-[(3R)-3-methylpiperazin-1-yl]but-2-enimidate |
|---|---|
| PubChem CID | 170194463 |
| Molecular Formula | C28H34F3N5O2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | [4-[[4-methyl-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl] (E)-N-[(E)-but-1-enyl]-3-[(3R)-3-methylpiperazin-1-yl]but-2-enimidate |
| SMILES | CC/C=C/N=C(\C=C(/C)N1CCN[C@H](C)C1)Oc1ccc(NC(=O)Nc2ccc(C)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C28H34F3N5O2/c1-5-6-13-33-26(16-21(4)36-15-14-32-20(3)18-36)38-24-11-9-22(10-12-24)34-27(37)35-23-8-7-19(2)25(17-23)28(29,30)31/h6-13,16-17,20,32H,5,14-15,18H2,1-4H3,(H2,34,35,37)/b13-6+,21-16+,33-26+/t20-/m1/s1 |
| InChIKey | XAJBARMSXSWREG-VJHNJZRTSA-N |
| XLogP | 6.56 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|