About 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine
4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 170194585) has the molecular formula C25H29N
and a molecular weight of 343.51 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine.
Molecular Properties
| Compound Name | 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine |
| PubChem CID | 170194585 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | CCC=CC(C)C1CC=CC=C1c1cc(-c2ccc(C)cc2C)ccn1 |
| InChI | InChI=1S/C25H29N/c1-5-6-9-19(3)23-10-7-8-11-24(23)25-17-21(14-15-26-25)22-13-12-18(2)16-20(22)4/h6-9,11-17,19,23H,5,10H2,1-4H3 |
| InChIKey | ORTNWIVVCSZVEE-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
The IUPAC name of 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine (CID 170194585) is 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine.
What is the SMILES notation for 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
The canonical SMILES for 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine is CCC=CC(C)C1CC=CC=C1c1cc(-c2ccc(C)cc2C)ccn1.
What is the InChIKey of 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
The InChIKey is ORTNWIVVCSZVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N/c1-5-6-9-19(3)23-10-7-8-11-24(23)25-17-21(14-15-26-25)22-13-12-18(2)16-20(22)4/h6-9,11-17,19,23H,5,10H2,1-4H3.
What are the key properties of 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine?
4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine has a molecular weight of 343.51 g/mol, XLogP of 6.93, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylphenyl)-2-(6-hex-3-en-2-ylcyclohexa-1,3-dien-1-yl)pyridine is sourced from PubChem (CID 170194585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).