About N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine
N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine (PubChem CID 170194791) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine.
Molecular Properties
| Compound Name | N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine |
| PubChem CID | 170194791 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine |
| SMILES | C/C=C\c1ccc(/C=C\C)c(/N=C/C)c1/N=C/C |
| InChI | InChI=1S/C16H20N2/c1-5-9-13-11-12-14(10-6-2)16(18-8-4)15(13)17-7-3/h5-12H,1-4H3/b9-5-,10-6-,17-7+,18-8+ |
| InChIKey | PZQGZXFFXLEROJ-LLMDQKGDSA-N |
| XLogP | 5.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine?
The IUPAC name of N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine (CID 170194791) is N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine.
What is the SMILES notation for N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine?
The canonical SMILES for N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine is C/C=C\c1ccc(/C=C\C)c(/N=C/C)c1/N=C/C.
What is the InChIKey of N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine?
The InChIKey is PZQGZXFFXLEROJ-LLMDQKGDSA-N. The full InChI is InChI=1S/C16H20N2/c1-5-9-13-11-12-14(10-6-2)16(18-8-4)15(13)17-7-3/h5-12H,1-4H3/b9-5-,10-6-,17-7+,18-8+.
What are the key properties of N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine?
N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine has a molecular weight of 240.35 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(ethylideneamino)-3,6-bis[(Z)-prop-1-enyl]phenyl]ethanimine is sourced from PubChem (CID 170194791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).