C22H22F3N5O2S — CID 17019520
N-(3,4-dimethylphenyl)-2-[4-ethyl-5-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide (PubChem CID 17019520) has the molecular formula C22H22F3N5O2S and a molecular weight of 477.51 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-ethyl-5-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-ethyl-5-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 17019520 |
| Molecular Formula | C22H22F3N5O2S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-ethyl-5-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanyl-1,2,4-triazol-3-yl]acetamide |
| SMILES | CCn1c(CC(=O)Nc2ccc(C)c(C)c2)nnc1SCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H22F3N5O2S/c1-4-30-17(10-18(31)26-14-6-5-12(2)13(3)9-14)28-29-22(30)33-11-19(32)27-16-8-7-15(23)20(24)21(16)25/h5-9H,4,10-11H2,1-3H3,(H,26,31)(H,27,32) |
| InChIKey | ZIPKUPGGRQWGSI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|