C23H27FN4O3S — CID 170195756
N-(4-fluorophenyl)-2-methyl-3-[2-[[1-(methylaminomethylsulfanylmethyl)cyclopropyl]amino]-2-oxoacetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxamide (PubChem CID 170195756) has the molecular formula C23H27FN4O3S and a molecular weight of 458.56 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-methyl-3-[2-[[1-(methylaminomethylsulfanylmethyl)cyclopropyl]amino]-2-oxoacetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-methyl-3-[2-[[1-(methylaminomethylsulfanylmethyl)cyclopropyl]amino]-2-oxoacetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxamide |
|---|---|
| PubChem CID | 170195756 |
| Molecular Formula | C23H27FN4O3S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-(4-fluorophenyl)-2-methyl-3-[2-[[1-(methylaminomethylsulfanylmethyl)cyclopropyl]amino]-2-oxoacetyl]-6,7-dihydro-5H-pyrrolizine-1-carboxamide |
| SMILES | CNCSCC1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(F)cc3)c3n2CCC3)CC1 |
| InChI | InChI=1S/C23H27FN4O3S/c1-14-18(21(30)26-16-7-5-15(24)6-8-16)17-4-3-11-28(17)19(14)20(29)22(31)27-23(9-10-23)12-32-13-25-2/h5-8,25H,3-4,9-13H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | YDMNKAYMOXDBGW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|