C21H13F4IO5S — CID 170196190
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 5-iodo-2-(2,3,5,6-tetrafluoro-4-sulfanylphenoxy)benzoate (PubChem CID 170196190) has the molecular formula C21H13F4IO5S and a molecular weight of 580.29 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 5-iodo-2-(2,3,5,6-tetrafluoro-4-sulfanylphenoxy)benzoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 5-iodo-2-(2,3,5,6-tetrafluoro-4-sulfanylphenoxy)benzoate |
|---|---|
| PubChem CID | 170196190 |
| Molecular Formula | C21H13F4IO5S |
| Molecular Weight | 580.29 g/mol |
| Exact Mass | 579.95 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 5-iodo-2-(2,3,5,6-tetrafluoro-4-sulfanylphenoxy)benzoate |
| SMILES | O=C(OC1C2CC3C(=O)OC1C3C2)c1cc(I)ccc1Oc1c(F)c(F)c(S)c(F)c1F |
| InChI | InChI=1S/C21H13F4IO5S/c22-12-14(24)19(32)15(25)13(23)18(12)29-11-2-1-7(26)5-10(11)21(28)30-16-6-3-8-9(4-6)20(27)31-17(8)16/h1-2,5-6,8-9,16-17,32H,3-4H2 |
| InChIKey | ZENKKNWBJKISRL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.29 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|