C28H35N5O4 — CID 170196961
6-amino-5-[2-[2-[amino(hydroxy)methyl]piperidin-1-yl]acetyl]-1,3-bis[(4-methylphenyl)methyl]pyrimidine-2,4-dione (PubChem CID 170196961) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is 6-amino-5-[2-[2-[amino(hydroxy)methyl]piperidin-1-yl]acetyl]-1,3-bis[(4-methylphenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[2-[2-[amino(hydroxy)methyl]piperidin-1-yl]acetyl]-1,3-bis[(4-methylphenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170196961 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 6-amino-5-[2-[2-[amino(hydroxy)methyl]piperidin-1-yl]acetyl]-1,3-bis[(4-methylphenyl)methyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Cn2c(N)c(C(=O)CN3CCCCC3C(N)O)c(=O)n(Cc3ccc(C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C28H35N5O4/c1-18-6-10-20(11-7-18)15-32-25(29)24(23(34)17-31-14-4-3-5-22(31)26(30)35)27(36)33(28(32)37)16-21-12-8-19(2)9-13-21/h6-13,22,26,35H,3-5,14-17,29-30H2,1-2H3 |
| InChIKey | LEPOGDOPOBCLOB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|