C20H33N — CID 170197140
(3Z,5Z)-5-ethyl-N-[(Z,3E)-3-ethylidenehex-4-en-2-yl]-2-propylhepta-3,5-dien-1-imine (PubChem CID 170197140) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is (3Z,5Z)-5-ethyl-N-[(Z,3E)-3-ethylidenehex-4-en-2-yl]-2-propylhepta-3,5-dien-1-imine.
| Compound Name | (3Z,5Z)-5-ethyl-N-[(Z,3E)-3-ethylidenehex-4-en-2-yl]-2-propylhepta-3,5-dien-1-imine |
|---|---|
| PubChem CID | 170197140 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (3Z,5Z)-5-ethyl-N-[(Z,3E)-3-ethylidenehex-4-en-2-yl]-2-propylhepta-3,5-dien-1-imine |
| SMILES | C/C=C\C(=C/C)C(C)/N=C/C(/C=C\C(=C/C)CC)CCC |
| InChI | InChI=1S/C20H33N/c1-7-12-19(15-14-18(9-3)10-4)16-21-17(6)20(11-5)13-8-2/h8-9,11,13-17,19H,7,10,12H2,1-6H3/b13-8-,15-14-,18-9-,20-11+,21-16+ |
| InChIKey | XYGNMEWVYJOADE-VTORAQEGSA-N |
| XLogP | 6.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|