C14H19ClO3S — CID 170197281
(2R,5S)-5-[(4-chlorophenyl)methyl]-2-(methylsulfonylmethyl)oxane (PubChem CID 170197281) has the molecular formula C14H19ClO3S and a molecular weight of 302.82 g/mol. Its IUPAC name is (2R,5S)-5-[(4-chlorophenyl)methyl]-2-(methylsulfonylmethyl)oxane.
| Compound Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-2-(methylsulfonylmethyl)oxane |
|---|---|
| PubChem CID | 170197281 |
| Molecular Formula | C14H19ClO3S |
| Molecular Weight | 302.82 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (2R,5S)-5-[(4-chlorophenyl)methyl]-2-(methylsulfonylmethyl)oxane |
| SMILES | CS(=O)(=O)C[C@H]1CC[C@@H](Cc2ccc(Cl)cc2)CO1 |
| InChI | InChI=1S/C14H19ClO3S/c1-19(16,17)10-14-7-4-12(9-18-14)8-11-2-5-13(15)6-3-11/h2-3,5-6,12,14H,4,7-10H2,1H3/t12-,14+/m0/s1 |
| InChIKey | AIWHKKKJPQOECP-GXTWGEPZSA-N |
| XLogP | 2.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.82 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |