C17H32N2 — CID 170197366
6,6-dimethyl-N,2-di(propan-2-yl)-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-imine (PubChem CID 170197366) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 6,6-dimethyl-N,2-di(propan-2-yl)-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-imine.
| Compound Name | 6,6-dimethyl-N,2-di(propan-2-yl)-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-imine |
|---|---|
| PubChem CID | 170197366 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 6,6-dimethyl-N,2-di(propan-2-yl)-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-imine |
| SMILES | CC(C)/N=C1\C2CCC(C)(C)CC2CCN1C(C)C |
| InChI | InChI=1S/C17H32N2/c1-12(2)18-16-15-7-9-17(5,6)11-14(15)8-10-19(16)13(3)4/h12-15H,7-11H2,1-6H3/b18-16+ |
| InChIKey | KSQBQRUWHMZWJJ-FBMGVBCBSA-N |
| XLogP | 4.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|