C25H33N4O8P — CID 170197538
2,2-dimethylpropyl [(2S,5R)-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl carbonate (PubChem CID 170197538) has the molecular formula C25H33N4O8P and a molecular weight of 548.53 g/mol. Its IUPAC name is 2,2-dimethylpropyl [(2S,5R)-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl carbonate.
| Compound Name | 2,2-dimethylpropyl [(2S,5R)-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 170197538 |
| Molecular Formula | C25H33N4O8P |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2,2-dimethylpropyl [(2S,5R)-5-[3-[[hydroxy(phenylmethoxy)phosphoryl]oxymethyl]-4-iminopyrrolo[2,1-f][1,2,4]triazin-7-yl]oxolan-2-yl]methyl carbonate |
| SMILES | [H]/N=c1/c2ccc([C@H]3CC[C@@H](COC(=O)OCC(C)(C)C)O3)n2ncn1COP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C25H33N4O8P/c1-25(2,3)15-34-24(30)33-14-19-9-12-22(37-19)20-10-11-21-23(26)28(16-27-29(20)21)17-36-38(31,32)35-13-18-7-5-4-6-8-18/h4-8,10-11,16,19,22,26H,9,12-15,17H2,1-3H3,(H,31,32)/b26-23-/t19-,22+/m0/s1 |
| InChIKey | NPVIFKMHXNGGLI-ZHQWXFPPSA-N |
| XLogP | 4.33 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|