C29H42S — CID 170199190
(3Z,5E)-7-ethenyl-4,5,6-trimethyl-13-methylidene-15-(4-methylphenyl)hexadeca-1,3,5-triene-2-thiol (PubChem CID 170199190) has the molecular formula C29H42S and a molecular weight of 422.72 g/mol. Its IUPAC name is (3Z,5E)-7-ethenyl-4,5,6-trimethyl-13-methylidene-15-(4-methylphenyl)hexadeca-1,3,5-triene-2-thiol.
| Compound Name | (3Z,5E)-7-ethenyl-4,5,6-trimethyl-13-methylidene-15-(4-methylphenyl)hexadeca-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 170199190 |
| Molecular Formula | C29H42S |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (3Z,5E)-7-ethenyl-4,5,6-trimethyl-13-methylidene-15-(4-methylphenyl)hexadeca-1,3,5-triene-2-thiol |
| SMILES | C=CC(CCCCCC(=C)CC(C)c1ccc(C)cc1)/C(C)=C(C)/C(C)=C\C(=C)S |
| InChI | InChI=1S/C29H42S/c1-9-28(27(8)26(7)23(4)20-25(6)30)14-12-10-11-13-22(3)19-24(5)29-17-15-21(2)16-18-29/h9,15-18,20,24,28,30H,1,3,6,10-14,19H2,2,4-5,7-8H3/b23-20-,27-26+ |
| InChIKey | VVWMXOCUYYVBDS-VYFJRVNISA-N |
| XLogP | 9.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|