C45H27N3S2 — CID 170199239
2,4-diphenyl-6-[8-(1-phenyldibenzothiophen-4-yl)dibenzothiophen-3-yl]-1,3,5-triazine (PubChem CID 170199239) has the molecular formula C45H27N3S2 and a molecular weight of 673.87 g/mol. Its IUPAC name is 2,4-diphenyl-6-[8-(1-phenyldibenzothiophen-4-yl)dibenzothiophen-3-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[8-(1-phenyldibenzothiophen-4-yl)dibenzothiophen-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 170199239 |
| Molecular Formula | C45H27N3S2 |
| Molecular Weight | 673.87 g/mol |
| Exact Mass | 673.16 |
| IUPAC Name | 2,4-diphenyl-6-[8-(1-phenyldibenzothiophen-4-yl)dibenzothiophen-3-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)sc3ccc(-c5ccc(-c6ccccc6)c6c5sc5ccccc56)cc34)n2)cc1 |
| InChI | InChI=1S/C45H27N3S2/c1-4-12-28(13-5-1)33-23-24-34(42-41(33)36-18-10-11-19-38(36)50-42)31-21-25-39-37(26-31)35-22-20-32(27-40(35)49-39)45-47-43(29-14-6-2-7-15-29)46-44(48-45)30-16-8-3-9-17-30/h1-27H |
| InChIKey | MJCKMDDPEDGMAH-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.87 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |