C19H27FN2 — CID 170199610
N-[(3Z,7Z)-7-[(E)-1-fluoroprop-1-enyl]deca-1,3,7,9-tetraen-4-yl]-1-piperidin-4-ylmethanimine (PubChem CID 170199610) has the molecular formula C19H27FN2 and a molecular weight of 302.44 g/mol. Its IUPAC name is N-[(3Z,7Z)-7-[(E)-1-fluoroprop-1-enyl]deca-1,3,7,9-tetraen-4-yl]-1-piperidin-4-ylmethanimine.
| Compound Name | N-[(3Z,7Z)-7-[(E)-1-fluoroprop-1-enyl]deca-1,3,7,9-tetraen-4-yl]-1-piperidin-4-ylmethanimine |
|---|---|
| PubChem CID | 170199610 |
| Molecular Formula | C19H27FN2 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | N-[(3Z,7Z)-7-[(E)-1-fluoroprop-1-enyl]deca-1,3,7,9-tetraen-4-yl]-1-piperidin-4-ylmethanimine |
| SMILES | C=C/C=C(CCC(=C/C=C)/C(F)=C\C)\N=C\C1CCNCC1 |
| InChI | InChI=1S/C19H27FN2/c1-4-7-17(19(20)6-3)9-10-18(8-5-2)22-15-16-11-13-21-14-12-16/h4-8,15-16,21H,1-2,9-14H2,3H3/b17-7-,18-8-,19-6+,22-15+ |
| InChIKey | SIEWZSPKDPJNHM-OAEOOTNTSA-N |
| XLogP | 4.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|