About N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine
N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine (PubChem CID 170199714) has the molecular formula C21H32N2
and a molecular weight of 312.50 g/mol. Its IUPAC name is N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine.
Molecular Properties
| Compound Name | N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine |
| PubChem CID | 170199714 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine |
| SMILES | C=C(/N=C(\C)C(/N=C/CCCCCC)=C(C)C)C1=CCCC=C1 |
| InChI | InChI=1S/C21H32N2/c1-6-7-8-9-13-16-22-21(17(2)3)19(5)23-18(4)20-14-11-10-12-15-20/h11,14-16H,4,6-10,12-13H2,1-3,5H3/b22-16+,23-19+ |
| InChIKey | MXJXBIMDMWGROX-SZAMPSRSSA-N |
| XLogP | 6.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine?
The IUPAC name of N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine (CID 170199714) is N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine.
What is the SMILES notation for N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine?
The canonical SMILES for N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine is C=C(/N=C(\C)C(/N=C/CCCCCC)=C(C)C)C1=CCCC=C1.
What is the InChIKey of N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine?
The InChIKey is MXJXBIMDMWGROX-SZAMPSRSSA-N. The full InChI is InChI=1S/C21H32N2/c1-6-7-8-9-13-16-22-21(17(2)3)19(5)23-18(4)20-14-11-10-12-15-20/h11,14-16H,4,6-10,12-13H2,1-3,5H3/b22-16+,23-19+.
What are the key properties of N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine?
N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine has a molecular weight of 312.50 g/mol, XLogP of 6.57, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-cyclohexa-1,5-dien-1-ylethenylimino)-2-methylpent-2-en-3-yl]heptan-1-imine is sourced from PubChem (CID 170199714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).