C23H31ClFN7O — CID 170200261
9-[4-[1-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]methylamino]ethenoxy]butyl]-2-N,2-N-dimethylpurine-2,6-diamine (PubChem CID 170200261) has the molecular formula C23H31ClFN7O and a molecular weight of 476.00 g/mol. Its IUPAC name is 9-[4-[1-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]methylamino]ethenoxy]butyl]-2-N,2-N-dimethylpurine-2,6-diamine.
| Compound Name | 9-[4-[1-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]methylamino]ethenoxy]butyl]-2-N,2-N-dimethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 170200261 |
| Molecular Formula | C23H31ClFN7O |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 9-[4-[1-[[4-chloro-3-(2-fluoropropan-2-yl)phenyl]methylamino]ethenoxy]butyl]-2-N,2-N-dimethylpurine-2,6-diamine |
| SMILES | C=C(NCc1ccc(Cl)c(C(C)(C)F)c1)OCCCCn1cnc2c(N)nc(N(C)C)nc21 |
| InChI | InChI=1S/C23H31ClFN7O/c1-15(27-13-16-8-9-18(24)17(12-16)23(2,3)25)33-11-7-6-10-32-14-28-19-20(26)29-22(31(4)5)30-21(19)32/h8-9,12,14,27H,1,6-7,10-11,13H2,2-5H3,(H2,26,29,30) |
| InChIKey | LSEXZWFBVQYMQV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|