C28H22N2O4 — CID 170201089
15,16-dihydroxy-12,19-dioxahexacyclo[18.8.0.02,11.03,8.013,18.023,28]octacosa-1(20),2(11),3(8),9,13(18),14,16,21,23(28)-nonaene-14,17-dicarbonitrile (PubChem CID 170201089) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is 15,16-dihydroxy-12,19-dioxahexacyclo[18.8.0.02,11.03,8.013,18.023,28]octacosa-1(20),2(11),3(8),9,13(18),14,16,21,23(28)-nonaene-14,17-dicarbonitrile.
| Compound Name | 15,16-dihydroxy-12,19-dioxahexacyclo[18.8.0.02,11.03,8.013,18.023,28]octacosa-1(20),2(11),3(8),9,13(18),14,16,21,23(28)-nonaene-14,17-dicarbonitrile |
|---|---|
| PubChem CID | 170201089 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 15,16-dihydroxy-12,19-dioxahexacyclo[18.8.0.02,11.03,8.013,18.023,28]octacosa-1(20),2(11),3(8),9,13(18),14,16,21,23(28)-nonaene-14,17-dicarbonitrile |
| SMILES | N#Cc1c(O)c(O)c(C#N)c2oc3ccc4c(c3c3c5c(ccc3oc12)CCCC5)CCCC4 |
| InChI | InChI=1S/C28H22N2O4/c29-13-19-25(31)26(32)20(14-30)28-27(19)33-21-11-9-15-5-1-3-7-17(15)23(21)24-18-8-4-2-6-16(18)10-12-22(24)34-28/h9-12,31-32H,1-8H2 |
| InChIKey | PCNARSMHFUNZPG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|