C15H18N4 — CID 170201197
N-[cyclohexa-1,5-dien-1-yl-(methylideneamino)methylidene]-N'-methyl-3,4-dihydropyridine-2-carboximidamide (PubChem CID 170201197) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-[cyclohexa-1,5-dien-1-yl-(methylideneamino)methylidene]-N'-methyl-3,4-dihydropyridine-2-carboximidamide.
| Compound Name | N-[cyclohexa-1,5-dien-1-yl-(methylideneamino)methylidene]-N'-methyl-3,4-dihydropyridine-2-carboximidamide |
|---|---|
| PubChem CID | 170201197 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-[cyclohexa-1,5-dien-1-yl-(methylideneamino)methylidene]-N'-methyl-3,4-dihydropyridine-2-carboximidamide |
| SMILES | C=N/C(=N\C(=N\C)C1=NC=CCC1)C1=CCCC=C1 |
| InChI | InChI=1S/C15H18N4/c1-16-14(12-8-4-3-5-9-12)19-15(17-2)13-10-6-7-11-18-13/h4,7-9,11H,1,3,5-6,10H2,2H3/b17-15+,19-14- |
| InChIKey | KBCMHORRZDSOKF-NXILBLEWSA-N |
| XLogP | 3.14 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|