C28H29N3 — CID 170201341
2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-6-naphthalen-2-yl-1,3,5-triazine (PubChem CID 170201341) has the molecular formula C28H29N3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-6-naphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-6-naphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 170201341 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2-[(3E,5Z)-hepta-3,5-dien-3-yl]-4-[(2E,4Z)-6-methylhepta-2,4,6-trien-3-yl]-6-naphthalen-2-yl-1,3,5-triazine |
| SMILES | C=C(C)/C=C\C(=C/C)c1nc(/C(=C/C=C\C)CC)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C28H29N3/c1-6-9-12-21(7-2)26-29-27(22(8-3)16-15-20(4)5)31-28(30-26)25-18-17-23-13-10-11-14-24(23)19-25/h6,8-19H,4,7H2,1-3,5H3/b9-6-,16-15-,21-12+,22-8+ |
| InChIKey | NYZNLERXUUOKBA-IWDFDQMZSA-N |
| XLogP | 7.60 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|