C24H32FN7O2 — CID 170201561
4-(4-amino-6-pyrrolidin-1-yl-8H-imidazo[4,5-e][1,3]diazepin-1-yl)butyl N-[[3-(1-fluoroethyl)phenyl]methyl]carbamate (PubChem CID 170201561) has the molecular formula C24H32FN7O2 and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-(4-amino-6-pyrrolidin-1-yl-8H-imidazo[4,5-e][1,3]diazepin-1-yl)butyl N-[[3-(1-fluoroethyl)phenyl]methyl]carbamate.
| Compound Name | 4-(4-amino-6-pyrrolidin-1-yl-8H-imidazo[4,5-e][1,3]diazepin-1-yl)butyl N-[[3-(1-fluoroethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 170201561 |
| Molecular Formula | C24H32FN7O2 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 4-(4-amino-6-pyrrolidin-1-yl-8H-imidazo[4,5-e][1,3]diazepin-1-yl)butyl N-[[3-(1-fluoroethyl)phenyl]methyl]carbamate |
| SMILES | CC(F)c1cccc(CNC(=O)OCCCCn2cnc3c2CN=C(N2CCCC2)N=C3N)c1 |
| InChI | InChI=1S/C24H32FN7O2/c1-17(25)19-8-6-7-18(13-19)14-28-24(33)34-12-5-4-11-32-16-29-21-20(32)15-27-23(30-22(21)26)31-9-2-3-10-31/h6-8,13,16-17H,2-5,9-12,14-15H2,1H3,(H,28,33)(H2,26,27,30) |
| InChIKey | OABLXDNDZTYBRL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|