C25H41FN2 — CID 170202071
(3E,5E)-1-N-[(E)-but-1-enyl]-5-(2,2-dimethylpropyl)-3-N-[5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]octa-3,5-diene-1,3-diamine (PubChem CID 170202071) has the molecular formula C25H41FN2 and a molecular weight of 388.62 g/mol. Its IUPAC name is (3E,5E)-1-N-[(E)-but-1-enyl]-5-(2,2-dimethylpropyl)-3-N-[5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]octa-3,5-diene-1,3-diamine.
| Compound Name | (3E,5E)-1-N-[(E)-but-1-enyl]-5-(2,2-dimethylpropyl)-3-N-[5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]octa-3,5-diene-1,3-diamine |
|---|---|
| PubChem CID | 170202071 |
| Molecular Formula | C25H41FN2 |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | (3E,5E)-1-N-[(E)-but-1-enyl]-5-(2,2-dimethylpropyl)-3-N-[5-(1-fluoroethyl)cyclohexa-1,5-dien-1-yl]octa-3,5-diene-1,3-diamine |
| SMILES | CC/C=C/NCC/C(=C\C(=C\CC)CC(C)(C)C)NC1=CCCC(C(C)F)=C1 |
| InChI | InChI=1S/C25H41FN2/c1-7-9-15-27-16-14-24(17-21(11-8-2)19-25(4,5)6)28-23-13-10-12-22(18-23)20(3)26/h9,11,13,15,17-18,20,27-28H,7-8,10,12,14,16,19H2,1-6H3/b15-9+,21-11-,24-17+ |
| InChIKey | VRJGNTTXHAXNHO-BHRRGJDASA-N |
| XLogP | 7.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|