C36H64N3O8P — CID 170202563
[(2S)-3-[[5-(hydroxymethyl)-6-methoxyhexyl]amino]-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-3-oxopropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 170202563) has the molecular formula C36H64N3O8P and a molecular weight of 697.90 g/mol. Its IUPAC name is [(2S)-3-[[5-(hydroxymethyl)-6-methoxyhexyl]amino]-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-3-oxopropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-3-[[5-(hydroxymethyl)-6-methoxyhexyl]amino]-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-3-oxopropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 170202563 |
| Molecular Formula | C36H64N3O8P |
| Molecular Weight | 697.90 g/mol |
| Exact Mass | 697.44 |
| IUPAC Name | [(2S)-3-[[5-(hydroxymethyl)-6-methoxyhexyl]amino]-2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-3-oxopropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](COP(=O)([O-])OCC[N+](C)(C)C)C(=O)NCCCCC(CO)COC |
| InChI | InChI=1S/C36H64N3O8P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26-35(41)38-34(32-47-48(43,44)46-29-28-39(2,3)4)36(42)37-27-24-23-25-33(30-40)31-45-5/h7-8,10-11,13-14,16-17,19-20,33-34,40H,6,9,12,15,18,21-32H2,1-5H3,(H2-,37,38,41,42,43,44)/b8-7-,11-10-,14-13-,17-16-,20-19-/t33?,34-/m0/s1 |
| InChIKey | LOZKJFWOYIIMSI-JOUBNKSQSA-N |
| XLogP | 5.14 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|