C38H66N2 — CID 170202672
1-N-hept-6-enyl-1-N'-methyl-1-N'-[(Z)-2-[(Z)-2-[2-[(Z,5E)-4-methyl-5-propylidenenon-6-en-3-yl]cyclopent-3-en-1-yl]ethenyl]oct-2-enyl]ethane-1,1-diamine (PubChem CID 170202672) has the molecular formula C38H66N2 and a molecular weight of 550.96 g/mol. Its IUPAC name is 1-N-hept-6-enyl-1-N'-methyl-1-N'-[(Z)-2-[(Z)-2-[2-[(Z,5E)-4-methyl-5-propylidenenon-6-en-3-yl]cyclopent-3-en-1-yl]ethenyl]oct-2-enyl]ethane-1,1-diamine.
| Compound Name | 1-N-hept-6-enyl-1-N'-methyl-1-N'-[(Z)-2-[(Z)-2-[2-[(Z,5E)-4-methyl-5-propylidenenon-6-en-3-yl]cyclopent-3-en-1-yl]ethenyl]oct-2-enyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 170202672 |
| Molecular Formula | C38H66N2 |
| Molecular Weight | 550.96 g/mol |
| Exact Mass | 550.52 |
| IUPAC Name | 1-N-hept-6-enyl-1-N'-methyl-1-N'-[(Z)-2-[(Z)-2-[2-[(Z,5E)-4-methyl-5-propylidenenon-6-en-3-yl]cyclopent-3-en-1-yl]ethenyl]oct-2-enyl]ethane-1,1-diamine |
| SMILES | C=CCCCCCNC(C)N(C)CC(/C=C\C1CC=CC1C(CC)C(C)C(/C=C\CC)=C/CC)=C\CCCCC |
| InChI | InChI=1S/C38H66N2/c1-9-14-17-19-21-30-39-33(7)40(8)31-34(24-20-18-15-10-2)28-29-36-26-22-27-38(36)37(13-5)32(6)35(23-12-4)25-16-11-3/h9,16,22-25,27-29,32-33,36-39H,1,10-15,17-21,26,30-31H2,2-8H3/b25-16-,29-28-,34-24-,35-23+ |
| InChIKey | ALDPUGBUBPAKAH-YOYZSIKUSA-N |
| XLogP | 10.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.96 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|