C14H21N — CID 170202737
1-tert-butyl-5-ethyl-2,3-dihydroindole (PubChem CID 170202737) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-tert-butyl-5-ethyl-2,3-dihydroindole.
| Compound Name | 1-tert-butyl-5-ethyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 170202737 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-tert-butyl-5-ethyl-2,3-dihydroindole |
| SMILES | CCc1ccc2c(c1)CCN2C(C)(C)C |
| InChI | InChI=1S/C14H21N/c1-5-11-6-7-13-12(10-11)8-9-15(13)14(2,3)4/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | YNQDVBHETMBGQE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |