About 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane
1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane (PubChem CID 170202745) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane |
| PubChem CID | 170202745 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane |
| SMILES | CC1=CC(N2CCCN(C(C)(C)C)CC2)=CCC1 |
| InChI | InChI=1S/C16H28N2/c1-14-7-5-8-15(13-14)17-9-6-10-18(12-11-17)16(2,3)4/h8,13H,5-7,9-12H2,1-4H3 |
| InChIKey | SKIKUXKPQDIRHW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane?
The IUPAC name of 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane (CID 170202745) is 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane.
What is the SMILES notation for 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane?
The canonical SMILES for 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane is CC1=CC(N2CCCN(C(C)(C)C)CC2)=CCC1.
What is the InChIKey of 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane?
The InChIKey is SKIKUXKPQDIRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-14-7-5-8-15(13-14)17-9-6-10-18(12-11-17)16(2,3)4/h8,13H,5-7,9-12H2,1-4H3.
What are the key properties of 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane?
1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane has a molecular weight of 248.41 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(5-methylcyclohexa-1,5-dien-1-yl)-1,4-diazepane is sourced from PubChem (CID 170202745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).