C25H26ClN7O4S — CID 170202970
4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-cyclohexa-1,3-dien-1-ylsulfonylindol-5-yl)methyl]carbamate (PubChem CID 170202970) has the molecular formula C25H26ClN7O4S and a molecular weight of 556.05 g/mol. Its IUPAC name is 4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-cyclohexa-1,3-dien-1-ylsulfonylindol-5-yl)methyl]carbamate.
| Compound Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-cyclohexa-1,3-dien-1-ylsulfonylindol-5-yl)methyl]carbamate |
|---|---|
| PubChem CID | 170202970 |
| Molecular Formula | C25H26ClN7O4S |
| Molecular Weight | 556.05 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 4-(6-amino-2-chloropurin-9-yl)butyl N-[(1-cyclohexa-1,3-dien-1-ylsulfonylindol-5-yl)methyl]carbamate |
| SMILES | Nc1nc(Cl)nc2c1ncn2CCCCOC(=O)NCc1ccc2c(ccn2S(=O)(=O)C2=CC=CCC2)c1 |
| InChI | InChI=1S/C25H26ClN7O4S/c26-24-30-22(27)21-23(31-24)32(16-29-21)11-4-5-13-37-25(34)28-15-17-8-9-20-18(14-17)10-12-33(20)38(35,36)19-6-2-1-3-7-19/h1-2,6,8-10,12,14,16H,3-5,7,11,13,15H2,(H,28,34)(H2,27,30,31) |
| InChIKey | ULFYLOAHTJOMOH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 147.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|