About 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane]
2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] (PubChem CID 170203438) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane].
Molecular Properties
| Compound Name | 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] |
| PubChem CID | 170203438 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] |
| SMILES | CC(C)(C)n1cc2c(n1)C1(CCC2)COC1 |
| InChI | InChI=1S/C13H20N2O/c1-12(2,3)15-7-10-5-4-6-13(8-16-9-13)11(10)14-15/h7H,4-6,8-9H2,1-3H3 |
| InChIKey | YEERBDKUONFTFA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane]?
The IUPAC name of 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] (CID 170203438) is 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane].
What is the SMILES notation for 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane]?
The canonical SMILES for 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] is CC(C)(C)n1cc2c(n1)C1(CCC2)COC1.
What is the InChIKey of 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane]?
The InChIKey is YEERBDKUONFTFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-12(2,3)15-7-10-5-4-6-13(8-16-9-13)11(10)14-15/h7H,4-6,8-9H2,1-3H3.
What are the key properties of 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane]?
2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] has a molecular weight of 220.32 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylspiro[5,6-dihydro-4H-indazole-7,3'-oxetane] is sourced from PubChem (CID 170203438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).