C24H33N3O2 — CID 170203857
N-[(2S)-4-methyl-1-oxo-1-[(1S,4R,5S)-1,4,6,6-tetramethyl-3-azabicyclo[3.1.0]hexan-3-yl]pentan-2-yl]-1H-indole-2-carboxamide (PubChem CID 170203857) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-oxo-1-[(1S,4R,5S)-1,4,6,6-tetramethyl-3-azabicyclo[3.1.0]hexan-3-yl]pentan-2-yl]-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-4-methyl-1-oxo-1-[(1S,4R,5S)-1,4,6,6-tetramethyl-3-azabicyclo[3.1.0]hexan-3-yl]pentan-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 170203857 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[(2S)-4-methyl-1-oxo-1-[(1S,4R,5S)-1,4,6,6-tetramethyl-3-azabicyclo[3.1.0]hexan-3-yl]pentan-2-yl]-1H-indole-2-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)c1cc2ccccc2[nH]1)C(=O)N1C[C@@]2(C)[C@@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C24H33N3O2/c1-14(2)11-19(22(29)27-13-24(6)20(15(27)3)23(24,4)5)26-21(28)18-12-16-9-7-8-10-17(16)25-18/h7-10,12,14-15,19-20,25H,11,13H2,1-6H3,(H,26,28)/t15-,19+,20+,24+/m1/s1 |
| InChIKey | NKSAUCPVWARBJL-OKFIXCSWSA-N |
| XLogP | 4.21 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |