C26H34N2 — CID 170204026
5-[(6R)-4,6-dimethylcyclohexa-1,3-dien-1-yl]-3-methyl-2-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-3H-imidazo[1,5-a]pyridine (PubChem CID 170204026) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 5-[(6R)-4,6-dimethylcyclohexa-1,3-dien-1-yl]-3-methyl-2-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-3H-imidazo[1,5-a]pyridine.
| Compound Name | 5-[(6R)-4,6-dimethylcyclohexa-1,3-dien-1-yl]-3-methyl-2-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-3H-imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 170204026 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 5-[(6R)-4,6-dimethylcyclohexa-1,3-dien-1-yl]-3-methyl-2-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-3H-imidazo[1,5-a]pyridine |
| SMILES | CC1=CC=C(C2=CC=CC3=CN(C4=C(C)C=C(C)CC4(C)C)C(C)N32)[C@H](C)C1 |
| InChI | InChI=1S/C26H34N2/c1-17-11-12-23(19(3)13-17)24-10-8-9-22-16-27(21(5)28(22)24)25-20(4)14-18(2)15-26(25,6)7/h8-12,14,16,19,21H,13,15H2,1-7H3/t19-,21?/m1/s1 |
| InChIKey | LPKKWPQSOQEYIZ-YMBRHYMPSA-N |
| XLogP | 6.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |